C20H23NO3 — CID 18129704
N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(2,4-dimethylphenyl)propanamide (PubChem CID 18129704) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(2,4-dimethylphenyl)propanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(2,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 18129704 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(2,4-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)NCCc2ccc3c(c2)OCO3)c(C)c1 |
| InChI | InChI=1S/C20H23NO3/c1-14-3-5-17(15(2)11-14)6-8-20(22)21-10-9-16-4-7-18-19(12-16)24-13-23-18/h3-5,7,11-12H,6,8-10,13H2,1-2H3,(H,21,22) |
| InChIKey | PMIXEGCKEJSFSB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |