C15H20N2O4 — CID 86822152
3-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]-N-propylpropanamide (PubChem CID 86822152) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]-N-propylpropanamide.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 86822152 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNC(=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O4/c1-2-6-16-14(18)5-7-17-15(19)9-11-3-4-12-13(8-11)21-10-20-12/h3-4,8H,2,5-7,9-10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | IBZORPHBDPTGEO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |