C14H18O4 — CID 156511955
2-methylpropyl 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 156511955) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-methylpropyl 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | 2-methylpropyl 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 156511955 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-methylpropyl 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | CC(C)COC(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18O4/c1-10(2)8-16-14(15)6-4-11-3-5-12-13(7-11)18-9-17-12/h3,5,7,10H,4,6,8-9H2,1-2H3 |
| InChIKey | OAYFUALJJYYINH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |