C22H26O7 — CID 172914213
3-(3,4,5-trimethoxyphenyl)propyl 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 172914213) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)propyl 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)propyl 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 172914213 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)propyl 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | COc1cc(CCCOC(=O)CCc2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C22H26O7/c1-24-19-12-16(13-20(25-2)22(19)26-3)5-4-10-27-21(23)9-7-15-6-8-17-18(11-15)29-14-28-17/h6,8,11-13H,4-5,7,9-10,14H2,1-3H3 |
| InChIKey | FSXOOJMBNVRAAB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|