C20H24N2O6 — CID 109022696
N-(1,3-benzodioxol-5-ylmethyl)-3-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 109022696) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 109022696 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NCCC(=O)NCc2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N2O6/c1-24-17-9-14(10-18(25-2)20(17)26-3)21-7-6-19(23)22-11-13-4-5-15-16(8-13)28-12-27-15/h4-5,8-10,21H,6-7,11-12H2,1-3H3,(H,22,23) |
| InChIKey | XCKGTKCLWBRHNY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|