C21H26N2O5 — CID 109022589
N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propanamide (PubChem CID 109022589) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109022589 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propanamide |
| SMILES | COc1ccc(CCNCCC(=O)NCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C21H26N2O5/c1-25-17-5-3-15(11-19(17)26-2)7-9-22-10-8-21(24)23-13-16-4-6-18-20(12-16)28-14-27-18/h3-6,11-12,22H,7-10,13-14H2,1-2H3,(H,23,24) |
| InChIKey | YCZCILVNCBUXIW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|