C19H22N2O4 — CID 109022658
N-(1,3-benzodioxol-5-ylmethyl)-3-(4-ethoxyanilino)propanamide (PubChem CID 109022658) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(4-ethoxyanilino)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-ethoxyanilino)propanamide |
|---|---|
| PubChem CID | 109022658 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-ethoxyanilino)propanamide |
| SMILES | CCOc1ccc(NCCC(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H22N2O4/c1-2-23-16-6-4-15(5-7-16)20-10-9-19(22)21-12-14-3-8-17-18(11-14)25-13-24-17/h3-8,11,20H,2,9-10,12-13H2,1H3,(H,21,22) |
| InChIKey | LQCCMPSHCCFAQU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|