C18H19FN2O3 — CID 109021165
N-(1,3-benzodioxol-5-ylmethyl)-3-[(4-fluorophenyl)methylamino]propanamide (PubChem CID 109021165) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[(4-fluorophenyl)methylamino]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[(4-fluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 109021165 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[(4-fluorophenyl)methylamino]propanamide |
| SMILES | O=C(CCNCc1ccc(F)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H19FN2O3/c19-15-4-1-13(2-5-15)10-20-8-7-18(22)21-11-14-3-6-16-17(9-14)24-12-23-16/h1-6,9,20H,7-8,10-12H2,(H,21,22) |
| InChIKey | CEKUMCRGCICZOF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|