C20H24N2O3 — CID 109022749
3-(1,3-benzodioxol-5-ylmethylamino)-N-(3-phenylpropyl)propanamide (PubChem CID 109022749) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)-N-(3-phenylpropyl)propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 109022749 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)-N-(3-phenylpropyl)propanamide |
| SMILES | O=C(CCNCc1ccc2c(c1)OCO2)NCCCc1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c23-20(22-11-4-7-16-5-2-1-3-6-16)10-12-21-14-17-8-9-18-19(13-17)25-15-24-18/h1-3,5-6,8-9,13,21H,4,7,10-12,14-15H2,(H,22,23) |
| InChIKey | WGRXEJOZRRCNJI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|