C16H18N2O4 — CID 109018590
N-(1,3-benzodioxol-5-ylmethyl)-3-(furan-2-ylmethylamino)propanamide (PubChem CID 109018590) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(furan-2-ylmethylamino)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(furan-2-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 109018590 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(furan-2-ylmethylamino)propanamide |
| SMILES | O=C(CCNCc1ccco1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H18N2O4/c19-16(5-6-17-10-13-2-1-7-20-13)18-9-12-3-4-14-15(8-12)22-11-21-14/h1-4,7-8,17H,5-6,9-11H2,(H,18,19) |
| InChIKey | DTRCRLVTKUQMMD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|