C21H23N3O3 — CID 109022588
N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(1H-indol-3-yl)ethylamino]propanamide (PubChem CID 109022588) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(1H-indol-3-yl)ethylamino]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(1H-indol-3-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109022588 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[2-(1H-indol-3-yl)ethylamino]propanamide |
| SMILES | O=C(CCNCCc1c[nH]c2ccccc12)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23N3O3/c25-21(24-12-15-5-6-19-20(11-15)27-14-26-19)8-10-22-9-7-16-13-23-18-4-2-1-3-17(16)18/h1-6,11,13,22-23H,7-10,12,14H2,(H,24,25) |
| InChIKey | RASWUITXJLRCAW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|