C18H15FN2O3 — CID 110851708
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluoro-1H-indol-3-yl)acetamide (PubChem CID 110851708) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluoro-1H-indol-3-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluoro-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 110851708 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-fluoro-1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2cccc(F)c12)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15FN2O3/c19-13-2-1-3-14-18(13)12(9-20-14)7-17(22)21-8-11-4-5-15-16(6-11)24-10-23-15/h1-6,9,20H,7-8,10H2,(H,21,22) |
| InChIKey | UCZVKIBATXGUFM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |