C21H21N3O4 — CID 990959
(2S)-2-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide (PubChem CID 990959) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (2S)-2-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide.
| Compound Name | (2S)-2-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 990959 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (2S)-2-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-3-(1H-indol-3-yl)propanamide |
| SMILES | CC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21N3O4/c1-13(25)24-18(9-15-11-22-17-5-3-2-4-16(15)17)21(26)23-10-14-6-7-19-20(8-14)28-12-27-19/h2-8,11,18,22H,9-10,12H2,1H3,(H,23,26)(H,24,25)/t18-/m0/s1 |
| InChIKey | CXPFBDOXXYERFC-SFHVURJKSA-N |
| XLogP | 2.26 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |