C23H25N5O4 — CID 55815927
4-[[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]methyl]-N-(2-amino-2-oxoethyl)benzamide (PubChem CID 55815927) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 4-[[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]methyl]-N-(2-amino-2-oxoethyl)benzamide.
| Compound Name | 4-[[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]methyl]-N-(2-amino-2-oxoethyl)benzamide |
|---|---|
| PubChem CID | 55815927 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 4-[[[2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]methyl]-N-(2-amino-2-oxoethyl)benzamide |
| SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCc1ccc(C(=O)NCC(N)=O)cc1 |
| InChI | InChI=1S/C23H25N5O4/c1-14(29)28-20(10-17-12-25-19-5-3-2-4-18(17)19)23(32)26-11-15-6-8-16(9-7-15)22(31)27-13-21(24)30/h2-9,12,20,25H,10-11,13H2,1H3,(H2,24,30)(H,26,32)(H,27,31)(H,28,29) |
| InChIKey | BIJOZVPWAILXKN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 146.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |