C29H32N6O3 — CID 54761314
N-(2-aminophenyl)-4-[[[2-[[2-(dimethylamino)acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]methyl]benzamide (PubChem CID 54761314) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[2-[[2-(dimethylamino)acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[2-[[2-(dimethylamino)acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 54761314 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[2-[[2-(dimethylamino)acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]methyl]benzamide |
| SMILES | CN(C)CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCc1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C29H32N6O3/c1-35(2)18-27(36)33-26(15-21-17-31-24-9-5-3-7-22(21)24)29(38)32-16-19-11-13-20(14-12-19)28(37)34-25-10-6-4-8-23(25)30/h3-14,17,26,31H,15-16,18,30H2,1-2H3,(H,32,38)(H,33,36)(H,34,37) |
| InChIKey | WJDZWANTLCXSNS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|