C32H29Cl2N5O3 — CID 174622450
N-(2-aminophenyl)-4-[[[2-formamido-3-(1H-indol-3-yl)propanoyl]amino]methyl]benzamide;1,3-dichlorobenzene (PubChem CID 174622450) has the molecular formula C32H29Cl2N5O3 and a molecular weight of 602.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[2-formamido-3-(1H-indol-3-yl)propanoyl]amino]methyl]benzamide;1,3-dichlorobenzene.
| Compound Name | N-(2-aminophenyl)-4-[[[2-formamido-3-(1H-indol-3-yl)propanoyl]amino]methyl]benzamide;1,3-dichlorobenzene |
|---|---|
| PubChem CID | 174622450 |
| Molecular Formula | C32H29Cl2N5O3 |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[2-formamido-3-(1H-indol-3-yl)propanoyl]amino]methyl]benzamide;1,3-dichlorobenzene |
| SMILES | Clc1cccc(Cl)c1.Nc1ccccc1NC(=O)c1ccc(CNC(=O)C(Cc2c[nH]c3ccccc23)NC=O)cc1 |
| InChI | InChI=1S/C26H25N5O3.C6H4Cl2/c27-21-6-2-4-8-23(21)31-25(33)18-11-9-17(10-12-18)14-29-26(34)24(30-16-32)13-19-15-28-22-7-3-1-5-20(19)22;7-5-2-1-3-6(8)4-5/h1-12,15-16,24,28H,13-14,27H2,(H,29,34)(H,30,32)(H,31,33);1-4H |
| InChIKey | CYZVZDMLCFMZRF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|