C13H14N2O2 — CID 123425108
N-[1-(1H-indol-3-yl)-3-oxobutan-2-yl]formamide (PubChem CID 123425108) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is N-[1-(1H-indol-3-yl)-3-oxobutan-2-yl]formamide.
| Compound Name | N-[1-(1H-indol-3-yl)-3-oxobutan-2-yl]formamide |
|---|---|
| PubChem CID | 123425108 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | N-[1-(1H-indol-3-yl)-3-oxobutan-2-yl]formamide |
| SMILES | CC(=O)C(Cc1c[nH]c2ccccc12)NC=O |
| InChI | InChI=1S/C13H14N2O2/c1-9(17)13(15-8-16)6-10-7-14-12-5-3-2-4-11(10)12/h2-5,7-8,13-14H,6H2,1H3,(H,15,16) |
| InChIKey | ZKQOOSWGFOPCOE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|