C32H27Cl2N5O3 — CID 54761488
N-[1-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2,4-dichlorobenzamide (PubChem CID 54761488) has the molecular formula C32H27Cl2N5O3 and a molecular weight of 600.51 g/mol. Its IUPAC name is N-[1-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 54761488 |
| Molecular Formula | C32H27Cl2N5O3 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | N-[1-[[4-[(2-aminophenyl)carbamoyl]phenyl]methylamino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2,4-dichlorobenzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C32H27Cl2N5O3/c33-22-13-14-24(25(34)16-22)31(41)39-29(15-21-18-36-27-7-3-1-5-23(21)27)32(42)37-17-19-9-11-20(12-10-19)30(40)38-28-8-4-2-6-26(28)35/h1-14,16,18,29,36H,15,17,35H2,(H,37,42)(H,38,40)(H,39,41) |
| InChIKey | GOPDGGKATMYIPF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|