C21H25N5O2 — CID 55636976
2-acetamido-N-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-(1H-indol-3-yl)propanamide (PubChem CID 55636976) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-acetamido-N-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | 2-acetamido-N-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 55636976 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-acetamido-N-[[2-(dimethylamino)-4-pyridinyl]methyl]-3-(1H-indol-3-yl)propanamide |
| SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCc1ccnc(N(C)C)c1 |
| InChI | InChI=1S/C21H25N5O2/c1-14(27)25-19(11-16-13-23-18-7-5-4-6-17(16)18)21(28)24-12-15-8-9-22-20(10-15)26(2)3/h4-10,13,19,23H,11-12H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | IEPZXDFTCKVHMJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |