C14H12N2O5 — CID 110866090
N-(1,3-benzodioxol-5-ylmethylcarbamoyl)furan-2-carboxamide (PubChem CID 110866090) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylcarbamoyl)furan-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylcarbamoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110866090 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylcarbamoyl)furan-2-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)NC(=O)c1ccco1 |
| InChI | InChI=1S/C14H12N2O5/c17-13(11-2-1-5-19-11)16-14(18)15-7-9-3-4-10-12(6-9)21-8-20-10/h1-6H,7-8H2,(H2,15,16,17,18) |
| InChIKey | LZZXJMJUOBAVFQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |