C9H11N3O3 — CID 62905779
1-amino-3-(1,3-benzodioxol-5-ylmethyl)urea (PubChem CID 62905779) has the molecular formula C9H11N3O3 and a molecular weight of 209.20 g/mol. Its IUPAC name is 1-amino-3-(1,3-benzodioxol-5-ylmethyl)urea.
| Compound Name | 1-amino-3-(1,3-benzodioxol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 62905779 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 1-amino-3-(1,3-benzodioxol-5-ylmethyl)urea |
| SMILES | NNC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H11N3O3/c10-12-9(13)11-4-6-1-2-7-8(3-6)15-5-14-7/h1-3H,4-5,10H2,(H2,11,12,13) |
| InChIKey | IPPOSRASELDSBL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|