C10H8F3NO3 — CID 795667
N-(1,3-benzodioxol-5-ylmethyl)-2,2,2-trifluoroacetamide (PubChem CID 795667) has the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 795667 |
| Molecular Formula | C10H8F3NO3 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO3/c11-10(12,13)9(15)14-4-6-1-2-7-8(3-6)17-5-16-7/h1-3H,4-5H2,(H,14,15) |
| InChIKey | NGNSCJFIZWKKCW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |