C12H8F7NO3 — CID 5086006
N-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 5086006) has the molecular formula C12H8F7NO3 and a molecular weight of 347.19 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 5086006 |
| Molecular Formula | C12H8F7NO3 |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F7NO3/c13-10(14,11(15,16)12(17,18)19)9(21)20-4-6-1-2-7-8(3-6)23-5-22-7/h1-3H,4-5H2,(H,20,21) |
| InChIKey | NDRDCBWABCNXJL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|