C15H18NO5- — CID 7189349
5-(1,3-benzodioxol-5-ylmethylamino)-3,3-dimethyl-5-oxopentanoate (PubChem CID 7189349) has the molecular formula C15H18NO5- and a molecular weight of 292.31 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylamino)-3,3-dimethyl-5-oxopentanoate.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylamino)-3,3-dimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 7189349 |
| Molecular Formula | C15H18NO5- |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylamino)-3,3-dimethyl-5-oxopentanoate |
| SMILES | CC(C)(CC(=O)[O-])CC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H19NO5/c1-15(2,7-14(18)19)6-13(17)16-8-10-3-4-11-12(5-10)21-9-20-11/h3-5H,6-9H2,1-2H3,(H,16,17)(H,18,19)/p-1 |
| InChIKey | MSSNCOIDSVBDPW-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |