C12H17N3O5S — CID 112992858
N-(1,3-benzodioxol-5-ylmethyl)-2-(dimethylsulfamoylamino)acetamide (PubChem CID 112992858) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(dimethylsulfamoylamino)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(dimethylsulfamoylamino)acetamide |
|---|---|
| PubChem CID | 112992858 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(dimethylsulfamoylamino)acetamide |
| SMILES | CN(C)S(=O)(=O)NCC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H17N3O5S/c1-15(2)21(17,18)14-7-12(16)13-6-9-3-4-10-11(5-9)20-8-19-10/h3-5,14H,6-8H2,1-2H3,(H,13,16) |
| InChIKey | RJIBOJRSNDYRRH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |