C9H11NO4S — CID 591044
N-(1,3-benzodioxol-5-ylmethyl)methanesulfonamide (PubChem CID 591044) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)methanesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 591044 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H11NO4S/c1-15(11,12)10-5-7-2-3-8-9(4-7)14-6-13-8/h2-4,10H,5-6H2,1H3 |
| InChIKey | JAOTTZZWODVWDG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |