C14H12ClNO4S — CID 825686
N-(1,3-benzodioxol-5-ylmethyl)-4-chlorobenzenesulfonamide (PubChem CID 825686) has the molecular formula C14H12ClNO4S and a molecular weight of 325.77 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 825686 |
| Molecular Formula | C14H12ClNO4S |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc2c(c1)OCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClNO4S/c15-11-2-4-12(5-3-11)21(17,18)16-8-10-1-6-13-14(7-10)20-9-19-13/h1-7,16H,8-9H2 |
| InChIKey | PRNQYJABDVJICK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |