C14H11F2NO4S — CID 110781069
N-[(3,4-difluorophenyl)methyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110781069) has the molecular formula C14H11F2NO4S and a molecular weight of 327.31 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110781069 |
| Molecular Formula | C14H11F2NO4S |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc(F)c(F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H11F2NO4S/c15-11-3-1-9(5-12(11)16)7-17-22(18,19)10-2-4-13-14(6-10)21-8-20-13/h1-6,17H,7-8H2 |
| InChIKey | OFUJICZTNINGDN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |