C15H13F2NO4S — CID 110788284
N-[2-(3,4-difluorophenyl)ethyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110788284) has the molecular formula C15H13F2NO4S and a molecular weight of 341.34 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)ethyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[2-(3,4-difluorophenyl)ethyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110788284 |
| Molecular Formula | C15H13F2NO4S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)ethyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(F)c(F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13F2NO4S/c16-12-3-1-10(7-13(12)17)5-6-18-23(19,20)11-2-4-14-15(8-11)22-9-21-14/h1-4,7-8,18H,5-6,9H2 |
| InChIKey | PUSALIPYIFRVBI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |