C19H22N2O5S — CID 110405037
N-[2-(4-morpholin-4-ylphenyl)ethyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110405037) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[2-(4-morpholin-4-ylphenyl)ethyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[2-(4-morpholin-4-ylphenyl)ethyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110405037 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[2-(4-morpholin-4-ylphenyl)ethyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(N2CCOCC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N2O5S/c22-27(23,17-5-6-18-19(13-17)26-14-25-18)20-8-7-15-1-3-16(4-2-15)21-9-11-24-12-10-21/h1-6,13,20H,7-12,14H2 |
| InChIKey | ICBXDLXDQIYZJN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|