C15H13Cl2NO4S — CID 18197812
N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,5-dichlorobenzenesulfonamide (PubChem CID 18197812) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 18197812 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc2c(c1)OCO2)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO4S/c16-11-6-12(17)8-13(7-11)23(19,20)18-4-3-10-1-2-14-15(5-10)22-9-21-14/h1-2,5-8,18H,3-4,9H2 |
| InChIKey | QIYQKNBLEXLLHC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |