C17H17NO6S — CID 31765938
methyl 3-[2-(1,3-benzodioxol-5-yl)ethylsulfamoyl]benzoate (PubChem CID 31765938) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is methyl 3-[2-(1,3-benzodioxol-5-yl)ethylsulfamoyl]benzoate.
| Compound Name | methyl 3-[2-(1,3-benzodioxol-5-yl)ethylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 31765938 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | methyl 3-[2-(1,3-benzodioxol-5-yl)ethylsulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NCCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H17NO6S/c1-22-17(19)13-3-2-4-14(10-13)25(20,21)18-8-7-12-5-6-15-16(9-12)24-11-23-15/h2-6,9-10,18H,7-8,11H2,1H3 |
| InChIKey | DRBYMCPJYIEOBS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |