C18H21NO6S — CID 31701712
methyl 3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]benzoate (PubChem CID 31701712) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is methyl 3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]benzoate.
| Compound Name | methyl 3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 31701712 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl 3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)NCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C18H21NO6S/c1-23-16-8-7-13(11-17(16)24-2)9-10-19-26(21,22)15-6-4-5-14(12-15)18(20)25-3/h4-8,11-12,19H,9-10H2,1-3H3 |
| InChIKey | OHYXJXDSMHSIJB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |