C19H21NO6S — CID 67019612
(E)-3-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 67019612) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is (E)-3-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67019612 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (E)-3-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(CCNS(=O)(=O)c2cccc(/C=C/C(=O)O)c2)cc1OC |
| InChI | InChI=1S/C19H21NO6S/c1-25-17-8-6-15(13-18(17)26-2)10-11-20-27(23,24)16-5-3-4-14(12-16)7-9-19(21)22/h3-9,12-13,20H,10-11H2,1-2H3,(H,21,22)/b9-7+ |
| InChIKey | AIWWOZLXMMRSOT-VQHVLOKHSA-N |
| XLogP | 2.32 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|