C20H26N2O6S — CID 99984969
5-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-2-(propylamino)benzoic acid (PubChem CID 99984969) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-2-(propylamino)benzoic acid.
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-2-(propylamino)benzoic acid |
|---|---|
| PubChem CID | 99984969 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-2-(propylamino)benzoic acid |
| SMILES | CCCNc1ccc(S(=O)(=O)NCCc2ccc(OC)c(OC)c2)cc1C(=O)O |
| InChI | InChI=1S/C20H26N2O6S/c1-4-10-21-17-7-6-15(13-16(17)20(23)24)29(25,26)22-11-9-14-5-8-18(27-2)19(12-14)28-3/h5-8,12-13,21-22H,4,9-11H2,1-3H3,(H,23,24) |
| InChIKey | DBPGFEUQOUITET-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |