C21H28N2O7S — CID 99985030
5-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-2-(3-methoxypropylamino)benzoic acid (PubChem CID 99985030) has the molecular formula C21H28N2O7S and a molecular weight of 452.53 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-2-(3-methoxypropylamino)benzoic acid.
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-2-(3-methoxypropylamino)benzoic acid |
|---|---|
| PubChem CID | 99985030 |
| Molecular Formula | C21H28N2O7S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-2-(3-methoxypropylamino)benzoic acid |
| SMILES | COCCCNc1ccc(S(=O)(=O)NCCc2ccc(OC)c(OC)c2)cc1C(=O)O |
| InChI | InChI=1S/C21H28N2O7S/c1-28-12-4-10-22-18-7-6-16(14-17(18)21(24)25)31(26,27)23-11-9-15-5-8-19(29-2)20(13-15)30-3/h5-8,13-14,22-23H,4,9-12H2,1-3H3,(H,24,25) |
| InChIKey | BTEHTXHHAWWUFA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|