C23H32N2O7S — CID 99986111
2-[2-(3,4-dimethoxyphenyl)ethylamino]-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid (PubChem CID 99986111) has the molecular formula C23H32N2O7S and a molecular weight of 480.58 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99986111 |
| Molecular Formula | C23H32N2O7S |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid |
| SMILES | COc1ccc(CCNc2ccc(S(=O)(=O)NCCCOC(C)C)cc2C(=O)O)cc1OC |
| InChI | InChI=1S/C23H32N2O7S/c1-16(2)32-13-5-11-25-33(28,29)18-7-8-20(19(15-18)23(26)27)24-12-10-17-6-9-21(30-3)22(14-17)31-4/h6-9,14-16,24-25H,5,10-13H2,1-4H3,(H,26,27) |
| InChIKey | LKQTVQNMRBDTRY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|