C18H28N2O6S — CID 99986124
2-[[(2S)-oxolan-2-yl]methylamino]-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid (PubChem CID 99986124) has the molecular formula C18H28N2O6S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-[[(2S)-oxolan-2-yl]methylamino]-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid.
| Compound Name | 2-[[(2S)-oxolan-2-yl]methylamino]-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99986124 |
| Molecular Formula | C18H28N2O6S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[[(2S)-oxolan-2-yl]methylamino]-5-(3-propan-2-yloxypropylsulfamoyl)benzoic acid |
| SMILES | CC(C)OCCCNS(=O)(=O)c1ccc(NC[C@@H]2CCCO2)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H28N2O6S/c1-13(2)25-10-4-8-20-27(23,24)15-6-7-17(16(11-15)18(21)22)19-12-14-5-3-9-26-14/h6-7,11,13-14,19-20H,3-5,8-10,12H2,1-2H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | OGSZVBDNCLRFTR-AWEZNQCLSA-N |
| XLogP | 2.07 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|