C16H24N2O6S — CID 133144403
2-(1-methoxypropan-2-ylamino)-5-(oxolan-2-ylmethylsulfamoyl)benzoic acid (PubChem CID 133144403) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-(1-methoxypropan-2-ylamino)-5-(oxolan-2-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 2-(1-methoxypropan-2-ylamino)-5-(oxolan-2-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 133144403 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-(1-methoxypropan-2-ylamino)-5-(oxolan-2-ylmethylsulfamoyl)benzoic acid |
| SMILES | COCC(C)Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1C(=O)O |
| InChI | InChI=1S/C16H24N2O6S/c1-11(10-23-2)18-15-6-5-13(8-14(15)16(19)20)25(21,22)17-9-12-4-3-7-24-12/h5-6,8,11-12,17-18H,3-4,7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | HLBSKKFMRVRACK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |