C16H24N2O5S — CID 99985396
2-(tert-butylamino)-5-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoic acid (PubChem CID 99985396) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is 2-(tert-butylamino)-5-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoic acid.
| Compound Name | 2-(tert-butylamino)-5-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 99985396 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-(tert-butylamino)-5-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoic acid |
| SMILES | CC(C)(C)Nc1ccc(S(=O)(=O)NC[C@H]2CCCO2)cc1C(=O)O |
| InChI | InChI=1S/C16H24N2O5S/c1-16(2,3)18-14-7-6-12(9-13(14)15(19)20)24(21,22)17-10-11-5-4-8-23-11/h6-7,9,11,17-18H,4-5,8,10H2,1-3H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | NGAHSMCTAJTLPZ-LLVKDONJSA-N |
| XLogP | 2.05 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |