C17H20N2O6S — CID 133144397
2-(furan-2-ylmethylamino)-5-(oxolan-2-ylmethylsulfamoyl)benzoic acid (PubChem CID 133144397) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)-5-(oxolan-2-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 2-(furan-2-ylmethylamino)-5-(oxolan-2-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 133144397 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-(furan-2-ylmethylamino)-5-(oxolan-2-ylmethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC2CCCO2)ccc1NCc1ccco1 |
| InChI | InChI=1S/C17H20N2O6S/c20-17(21)15-9-14(26(22,23)19-11-13-4-2-8-25-13)5-6-16(15)18-10-12-3-1-7-24-12/h1,3,5-7,9,13,18-19H,2,4,8,10-11H2,(H,20,21) |
| InChIKey | HSQXXOFXCXOBKZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |