C15H16N2O5S — CID 99985163
2-(cyclopropylamino)-5-(furan-2-ylmethylsulfamoyl)benzoic acid (PubChem CID 99985163) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-(cyclopropylamino)-5-(furan-2-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 2-(cyclopropylamino)-5-(furan-2-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99985163 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-(cyclopropylamino)-5-(furan-2-ylmethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCc2ccco2)ccc1NC1CC1 |
| InChI | InChI=1S/C15H16N2O5S/c18-15(19)13-8-12(5-6-14(13)17-10-3-4-10)23(20,21)16-9-11-2-1-7-22-11/h1-2,5-8,10,16-17H,3-4,9H2,(H,18,19) |
| InChIKey | QQVHBPSCJATIPB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |