C20H24N2O4S — CID 99984246
5-(benzylsulfamoyl)-2-(cyclohexylamino)benzoic acid (PubChem CID 99984246) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 5-(benzylsulfamoyl)-2-(cyclohexylamino)benzoic acid.
| Compound Name | 5-(benzylsulfamoyl)-2-(cyclohexylamino)benzoic acid |
|---|---|
| PubChem CID | 99984246 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 5-(benzylsulfamoyl)-2-(cyclohexylamino)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCc2ccccc2)ccc1NC1CCCCC1 |
| InChI | InChI=1S/C20H24N2O4S/c23-20(24)18-13-17(11-12-19(18)22-16-9-5-2-6-10-16)27(25,26)21-14-15-7-3-1-4-8-15/h1,3-4,7-8,11-13,16,21-22H,2,5-6,9-10,14H2,(H,23,24) |
| InChIKey | OKYOPEAWPQBSCN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |