C15H22N2O4S — CID 99981604
2-(cyclopentylamino)-5-(propylsulfamoyl)benzoic acid (PubChem CID 99981604) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(cyclopentylamino)-5-(propylsulfamoyl)benzoic acid.
| Compound Name | 2-(cyclopentylamino)-5-(propylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99981604 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(cyclopentylamino)-5-(propylsulfamoyl)benzoic acid |
| SMILES | CCCNS(=O)(=O)c1ccc(NC2CCCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H22N2O4S/c1-2-9-16-22(20,21)12-7-8-14(13(10-12)15(18)19)17-11-5-3-4-6-11/h7-8,10-11,16-17H,2-6,9H2,1H3,(H,18,19) |
| InChIKey | UIQQVBQAXIYHIQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |