C14H20N2O5S — CID 99982970
5-(cyclopentylsulfamoyl)-2-(2-hydroxyethylamino)benzoic acid (PubChem CID 99982970) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 5-(cyclopentylsulfamoyl)-2-(2-hydroxyethylamino)benzoic acid.
| Compound Name | 5-(cyclopentylsulfamoyl)-2-(2-hydroxyethylamino)benzoic acid |
|---|---|
| PubChem CID | 99982970 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-(cyclopentylsulfamoyl)-2-(2-hydroxyethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NC2CCCC2)ccc1NCCO |
| InChI | InChI=1S/C14H20N2O5S/c17-8-7-15-13-6-5-11(9-12(13)14(18)19)22(20,21)16-10-3-1-2-4-10/h5-6,9-10,15-17H,1-4,7-8H2,(H,18,19) |
| InChIKey | MFZNLXUXSNTOQH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |