C14H22N2O5S — CID 132651451
2-(2-hydroxyethylamino)-5-(pentan-2-ylsulfamoyl)benzoic acid (PubChem CID 132651451) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-5-(pentan-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-(2-hydroxyethylamino)-5-(pentan-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 132651451 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(2-hydroxyethylamino)-5-(pentan-2-ylsulfamoyl)benzoic acid |
| SMILES | CCCC(C)NS(=O)(=O)c1ccc(NCCO)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H22N2O5S/c1-3-4-10(2)16-22(20,21)11-5-6-13(15-7-8-17)12(9-11)14(18)19/h5-6,9-10,15-17H,3-4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | AEOMZJRXPSPPFJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |