C15H24N2O4S — CID 99982166
5-[[(2R)-butan-2-yl]sulfamoyl]-2-(butylamino)benzoic acid (PubChem CID 99982166) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 5-[[(2R)-butan-2-yl]sulfamoyl]-2-(butylamino)benzoic acid.
| Compound Name | 5-[[(2R)-butan-2-yl]sulfamoyl]-2-(butylamino)benzoic acid |
|---|---|
| PubChem CID | 99982166 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-[[(2R)-butan-2-yl]sulfamoyl]-2-(butylamino)benzoic acid |
| SMILES | CCCCNc1ccc(S(=O)(=O)N[C@H](C)CC)cc1C(=O)O |
| InChI | InChI=1S/C15H24N2O4S/c1-4-6-9-16-14-8-7-12(10-13(14)15(18)19)22(20,21)17-11(3)5-2/h7-8,10-11,16-17H,4-6,9H2,1-3H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | RNBBWZODSSUXOF-LLVKDONJSA-N |
| XLogP | 2.67 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|