C16H26N2O6S — CID 99987044
2-(3-ethoxypropylamino)-5-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid (PubChem CID 99987044) has the molecular formula C16H26N2O6S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-(3-ethoxypropylamino)-5-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-(3-ethoxypropylamino)-5-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 99987044 |
| Molecular Formula | C16H26N2O6S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-(3-ethoxypropylamino)-5-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid |
| SMILES | CCOCCCNc1ccc(S(=O)(=O)N[C@@H](C)COC)cc1C(=O)O |
| InChI | InChI=1S/C16H26N2O6S/c1-4-24-9-5-8-17-15-7-6-13(10-14(15)16(19)20)25(21,22)18-12(2)11-23-3/h6-7,10,12,17-18H,4-5,8-9,11H2,1-3H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | XTAYJODTTDQYPN-LBPRGKRZSA-N |
| XLogP | 1.54 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|