C13H20N2O5S — CID 99988329
2-(ethylamino)-5-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid (PubChem CID 99988329) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-(ethylamino)-5-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-(ethylamino)-5-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 99988329 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-(ethylamino)-5-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid |
| SMILES | CCNc1ccc(S(=O)(=O)N[C@H](C)COC)cc1C(=O)O |
| InChI | InChI=1S/C13H20N2O5S/c1-4-14-12-6-5-10(7-11(12)13(16)17)21(18,19)15-9(2)8-20-3/h5-7,9,14-15H,4,8H2,1-3H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | FYRMJRYUUOVQJX-SECBINFHSA-N |
| XLogP | 1.13 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |