C15H22N2O5S — CID 99982757
2-(3-ethoxypropylamino)-5-(prop-2-enylsulfamoyl)benzoic acid (PubChem CID 99982757) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(3-ethoxypropylamino)-5-(prop-2-enylsulfamoyl)benzoic acid.
| Compound Name | 2-(3-ethoxypropylamino)-5-(prop-2-enylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99982757 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-(3-ethoxypropylamino)-5-(prop-2-enylsulfamoyl)benzoic acid |
| SMILES | C=CCNS(=O)(=O)c1ccc(NCCCOCC)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H22N2O5S/c1-3-8-17-23(20,21)12-6-7-14(13(11-12)15(18)19)16-9-5-10-22-4-2/h3,6-7,11,16-17H,1,4-5,8-10H2,2H3,(H,18,19) |
| InChIKey | UVAYVNYRPZAALX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|